  (Ipc)2B-Allyl - see: Allyl-B(Ipc)2; Crotyl-B(Ipc)2
  (Ipc)2B-H - see: BH(Ipc)2
  15-crown-5: 1, 2, 3
  18-crown-6: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  9-BBN: 1, 2
  9-BBN-X - see: B(X)-BBN
  Ac2O - see: Acetic anhydride
  AcCl - see: Acetyl chloride
  Acetaldehyde: 1, 2, 3, 4, 5, 6, 7, 8
  Acetamide, bistrimethylsilyl: 1
  Acetamide, trifluoro: 1
  Acetate - see: AgOAc, B(OAc)3, Cu(OAc)2, CsOAc, Hg(OAc)2, Pb(OAc)4, Mn(OAc)3, Rh2(OAc)4
  Acetate, ammonium: 1, 2, 3, 4, 5, 6, 7
  Acetate, cesium: 1, 2, 3, 4
  Acetate, ortho - see: Orthoacetate
  Acetate, potassium: 1, 2, 3
  Acetate, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  Acetic acid: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107
  Acetic acid, trifluoro: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78
  Acetic anhydride: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51
  Acetic anhydride, DMAP: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21
  Acetic anhydride, NEt3: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Acetic anhydride, Py: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  Acetic anhydride, trifluoro: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  Acetoacetate: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  Acetone (react): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  Acetone (solvent): 1, 2, 3, 4, 5, 6
  Acetone (solvent) - see: Keywords - Finkelstein
  Acetonitrile (solvent): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Acetonitrile, trichloro: 1, 2
  Acetyl chloride: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Acetyl chloride, trichoro: 1
  Acetylene dicarboxylate: 1, 2, 3
  AcOCHO - see: Formic acetic anhydride
  AcOH - see: Acetic acid
  Acrolein: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Acrylamide: 1
  Acrylate: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28
  Acrylonitrile: 1, 2, 3, 4, 5, 6
  Acryloyl-Cl: 1, 2, 3, 4, 5, 6, 7
  AcSH - see: Thiol, acetyl
  Acyl imidazole: 1
  AD-Mix: 1, 2, 3
  Ag(O2CCF3)2: 1
  Ag2CO3: 1, 2, 3
  Ag2O: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  Ag3PO4: 1
  AgBF4: 1, 2, 3
  AgClO4: 1
  AgNO3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  AgOAc: 1, 2
  AgOC(O)CF3: 1
  AgOCOCF3: 1
  AgPF6: 1
  AIBN: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47
  Al(Hg): 1, 2, 3, 4, 5
  Al(OiPr)3: 1, 2
  Al(OtBu)3: 1
  Al(OR)4Li: 1
  Al(SiMe3)3: 1
  Al2O3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  AlCl3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  AlEt2-Cl: 1, 2, 3, 4
  AlEt2-CN - see: Cyanide, AlR2
  AlEt2-SnBu3 - see: SnBu3-AlEt2
  AlEt3: 1, 2, 3, 4
  AlEtCl2: 1, 2, 3
  AlH(OtBu)3-Li+: 1, 2, 3, 4, 5, 6
  AlH(OEt)3-Li+: 1
  AlH(OMe)3-Li+: 1
  AlH(OR)2iBu-Na+: 1
  AlH2(OR)2-Na+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  AlH3: 1, 2, 3, 4, 5
  AlH4-Li+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152, 153, 154, 155, 156, 157, 158, 159, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 174, 175, 176, 177, 178, 179, 180, 181, 182, 183, 184, 185, 186, 187, 188, 189, 190, 191, 192, 193, 194, 195, 196, 197, 198, 199, 200, 201, 202, 203, 204, 205, 206, 207
  AlHiBu2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152, 153, 154
  Alkenyl-X - see: Vinyl-X
  Alkyl-BR2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Alkyl-Cu: 1, 2, 3
  Alkyl-Cu - see: Keywords - Cu-Alkyl
  Alkyl-Li: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  Alkyl-Li - see: BuLi; MeLi
  Alkyl-MgBr: 1, 2, 3
  Alkyl-MgX: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51
  Alkyl-SnR3: 1, 2, 3
  Alkyl-ZnX: 1, 2, 3, 4
  Alkynyl-Br: 1
  Alkynyl-BR2: 1, 2, 3
  Alkynyl-CeX2: 1, 2
  Alkynyl-I: 1, 2, 3
  Alkynyl-K: 1, 2
  Alkynyl-Li: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39
  Alkynyl-MgX: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  Alkynyl-Na: 1, 2
  Alkynyl-SiR3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28
  Alkynyl-SnR3: 1, 2, 3, 4
  Alkynyl-Sulfone: 1
  Alkynyl-ZnX: 1, 2, 3, 4, 5, 6, 7
  Allene dicarboxylate: 1, 2, 3
  Allenyl-AlR2: 1
  Allenyl-BR2: 1, 2, 3
  Allenyl-I: 1, 2
  Allenyl-Li: 1, 2, 3, 4, 5, 6
  Allenyl-MgX: 1
  Allenyl-SiR3: 1, 2
  Allenyl-SnR3: 1, 2
  Allenyl-Sulfone: 1
  Allenyl-Ti: 1
  Allenyl-ZnX: 1
  Alloc-Cl: 1
  Allyl-B(Ipc)2: 1, 2, 3, 4, 5, 6, 7
  Allyl-B(Ipc)2 - see: Crotyl-B(Ipc)2
  Allyl-B(tartrate): 1, 2, 3
  Allyl-Br: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47
  Allyl-BR2: 1, 2, 3, 4, 5, 6
  Allyl-Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  Allyl-Cuprate: 1
  Allyl-I: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Allyl-In: 1
  Allyl-Li: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  Allyl-MgX: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Allyl-MgX - see: Crotyl-MgX
  Allyl-NH2: 1
  Allyl-OAc: 1, 2
  Allyl-OH: 1, 2, 3, 4, 5, 6, 7
  Allyl-Phosphate: 1
  Allyl-SiR3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  Allyl-SnR3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Allyl-ZnX: 1, 2
  AlMe2-SeMe - see: SeMe-AlMe2
  AlMe2-Cl: 1, 2
  AlMe2-CN - see: Cyanide-AlR2
  AlMe2-NR2: 1, 2
  AlMe3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  AlMe3 - see: NMe(OMe)AlMe2
  AlMeCl2: 1
  Aluminum hydrides - see: AlH3; BINAL-H; AlHiBu2; AlH4-Li+; AlH(OtBu)3-Li+; AlH3OEt-Li+; AlH2(OR)2-Na+
  Amalgam - see: Al(Hg), Na(Hg), Mg(Hg)
  Amberlite: 1, 2
  Amberlyst: 1, 2, 3, 4, 5, 6
  Amine - see: NH2R; NHR2; NR3
  Amine oxide - see: NMO; RuO4-Pr4N+, NMO; NMe3(O)
  Ammonia - see: NH3
  Ammonium - see: NH4X; Bu4NX
  Amyl nitrite: 1
  Aryl-Li: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  Aryl-Li - also see: Ph-Li, Furyl-Li; Mesityl-Li; Pyridyl-Li; Pyrrolyl-Li
  Aryl-MgX: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Aryl-SnR3: 1, 2, 3
  AsPh3: 1, 2, 3, 4, 5, 6, 7, 8
  AuCl·L: 1, 2
  AuCl3: 1
  AuClPPh3: 1
  AuNTf2: 1, 2, 3
  AuX: 1
  Azide, diphenylphosphoryl: 1, 2, 3, 4, 5, 6
  Azide, R4N+: 1
  Azide, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Azide, sulfonyl: 1, 2
  Azide, trimethylsilyl: 1
  Azide, zinc: 1
  Aziridine: 1, 2, 3, 4, 5, 6, 7
  B(Br)-BBN: 1
  B(Br)3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  B(Br)Me2: 1
  B(Cl)(c-Hx)2: 1, 2, 3
  B(Cl)3: 1, 2, 3, 4, 5
  B(I)-BBN: 1, 2
  B(OAc)3: 1
  B(OMe)-BBN: 1, 2
  B(OMe)3: 1, 2
  B(OR)2Alkyl: 1
  B(OTf)-BBN: 1, 2
  B(OTf)R2: 1
  B2(Pinacol)2: 1, 2, 3
  Ba° (Rieke): 1
  Ba(ClO3)2: 1, 2
  Ba(OH)2 - see: Hydroxide, barium
  Baker's yeast: 1, 2
  BaMnO4 - see: Permanganate, barium
  Barton ester - see: Mercaptopyridine-N-oxide
  BBrMe2: 1
  BCl(Catechol): 1
  BCl(Ipc)2: 1, 2, 3, 4, 5
  Benzaldehyde: 1
  Benzoate, cesium: 1
  Benzoic acid: 1
  Benzoic acid, p-nitro: 1, 2
  Benzophenone: 1
  Benzoyl chloride: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  Benzoyl chloride, 2,4,6-trichloro: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Benzoyl chloride, 2,4,6-trimethyl: 1
  Benzoyl peroxide: 1, 2
  Benzoyl triflate: 1
  Benzyl, p-methoxy - see: PMB
  Benzyl-Li: 1, 2, 3, 4, 5
  Benzyl-X: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  Benzylamine - see: NH2Bn
  Bestmann reagent - see: Diazophosphonate
  Bestmann ylide - see: PPh3=C=C=O
  BEt3: 1, 2, 3, 4
  BF3: 1, 2, 3, 4, 5, 6, 7, 8
  BF3·OEt2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82
  BF3·THF: 1
  BH(sBu3)-K+: 1, 2, 3, 4, 5, 6
  BH(sBu3)-Li+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  BH(Catechol): 1, 2, 3, 4
  BH(Cy)2: 1
  BH(Et)3-Li+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  BH(Ipc)2: 1
  BH(OAc)3-Me4N+: 1, 2, 3, 4, 5, 6, 7
  BH(OAc)3-Na+: 1, 2, 3, 4, 5, 6, 7
  BH(Pinacol): 1, 2
  BH(Siam)2: 1, 2, 3, 4, 5, 6, 7, 8
  BH-BBN: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  BH2(Thexyl): 1, 2, 3, 4, 5
  BH3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  BH3·NH3: 1
  BH3·SMe2: 1, 2, 3, 4, 5, 6, 7, 8
  BH3·THF: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  BH3CN-Na+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26
  BH3NH2-Li+: 1
  BH4-K+: 1
  BH4-Li+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  BH4-Na+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123
  BH4-Na+, CeCl3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20
  BH4-Na+, TiCl4: 1
  BH4-R4N+: 1
  BHT: 1, 2, 3, 4, 5
  BiBr3: 1
  Bicarbonate, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  Bifluoride, potassium: 1, 2
  BINAL-H: 1
  BINAP: 1, 2, 3, 4
  Binaphthol: 1
  Bisulfate, potassium: 1, 2
  Bisulfate, R4N+: 1
  Bisulfate, sodium: 1, 2, 3, 4
  BMe(OH)2: 1
  Boc-Cl: 1
  Boc2O: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20
  BOP: 1, 2, 3, 4
  Borabicyclonane - see: BH-BBN; B(X)-BBN; Alkyl-BR2
  Boron hydride - see: BH-BBN; BH3; BH(Siam)2; BH(Ipc)2; BH(Catechol); BH3NH2-Li+; BH4-Li+; BHEt3-Li+; BHsBu3-Li+; BHsBu3-K+; BH3CN-Na+; BH4-Na+; BH2(Thexyl); Zn(BH4)2
  BOTfBu2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  Br-CH2CO2R - see: Bromoacetate
  Br2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  BrCCl3: 1
  Bredereck reagent: 1
  Bromide - see: BBr3, CuBr, ZnBr2
  Bromide, lithium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  Bromide, R4N+: 1, 2, 3, 4
  Bromine - see: Br2; Tribromide; PPh3, Br2
  Bromoacetaldehyde: 1
  Bromoacetamide-N: 1, 2
  Bromoacetate: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21
  Bromocyclohexadienone: 1
  Bromoethanol: 1, 2, 3
  Bromoethylamine: 1
  Bromoform - see: CHBr3
  Bromohydantoin: 1, 2
  Bromopyruvate: 1, 2
  BTPP - see: Phosphazene base
  Bu2AlH - see: AlHiBu2
  Bu2SnH2 - see: HSnBu2H
  Bu2SnO - see: SnBu2(O)
  Bu3P - see: PBu3
  Bu3Sn-X - see: SnBu3-X
  Bu3SnH - see: HSnBu3
  Bu3SnLi - see: LiSnR3
  Bu4N+ BH4- - see: BH4-R4N+
  Bu4N+ Br- - see: Bromide, R4N+
  Bu4N+ F- - see: Fluoride, R4N+
  Bu4N+ HSO4- - see: Bisulfate, R4N+
  Bu4N+ I- - see: Iodide, R4N+
  Bu4N+ IO4- - see: Periodate, R4N+
  Bu4N+ N3- - see: Azide, R4N+
  BuLi(n): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149
  BuLi(n), HMPA: 1, 2, 3, 4
  BuLi(sec): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  BuLi(sec), TMEDA: 1, 2, 3
  BuLi(tert): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53
  BuLi(tert), HMPA: 1, 2
  BuLi, KOtBu: 1, 2
  BuLi, Sparteine: 1, 2
  BuOCl - see: Hypochlorite, tbutyl
  BuOOH - see: Hydroperoxide, tbutyl
  Burgess reagent: 1, 2, 3, 4
  BuSH - see: Thiol, n-butyl
  Butadiene: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Butadiene, 1-NR2: 1, 2, 3, 4, 5
  Butadiene, 1-OR: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  Butadiene, 1-SnR3: 1
  Butadiene, 1-SR: 1
  Butadiene, 2-OR: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  Bz2O2 - see: Benzoyl peroxide
  BzCl - see: Benzoyl chloride
  Ca°/NH3: 1, 2, 3, 4
  CaCl2 - see: Chloride, calcium
  CaCO3 - see: Carbonate, calcium
  Camphor oxaziridine - see: Oxaziridine, Camphor
  Camphor sulfonic acid: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36
  CAN - see: Ceric ammonium nitrate
  Carbamoyl chloride - see: O=C(NR2)Cl
  Carbodiimide: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43
  Carbon dioxide - see: CO2
  Carbon monoxide - see: CO; PdX2, CO
  Carbonate - see: Ag2CO3;Tl2CO3
  Carbonate, calcium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25
  Carbonate, cesium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Carbonate, dialkyl - see: O=C(OR)2
  Carbonate, lithium: 1, 2, 3
  Carbonate, potassium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110
  Carbonate, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Carbonates - see: O=CX2
  Carvone: 1
  Catechol borane - see: BH(Catechol)
  CBr4: 1, 2
  CBr4 - see: PPh3, CBr4
  CBS (Corey-Bakshi-Shibata) catalyst - see: Corey oxazaborolidine
  Cbz-Succinimide: 1
  CbzCl: 1
  CCl4 - see: PBu3, CCl4
  Cd/Pb: 1
  CdCl2: 1
  CDI - see: O=C(Imid)2
  CeCl3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  CeCl3 - see: BH4-Na+, CeCl3
  Ceric ammonium nitrate: 1, 2, 3, 4, 5, 6, 7, 8
  CF3CH2OH - see: Trifluoroethanol
  CF3CH2OH(solvent): 1, 2, 3, 4
  CF3CO2Ag - see: AgOCOCF3
  CF3CO2C(O)CF3 - see: Acetic anhydride, trifluoro
  CF3CO2H - see: Acetic acid, trifluoro
  CF3CONH2 - see: Acetamide, trifluoro
  CF3SO3H - see: TfOH
  CH(OMe)3 - see: Orthoacetate
  CH2(NMe2)2: 1
  CH2(OMe)2: 1, 2, 3
  CH2=C(OLi)(OR): 1, 2, 3, 4, 5, 6
  CH2=C(OLi)2: 1, 2
  CH2=C(OMe)Me - see: Propenyl-OR}
  CH2=C(OR)(OSiR'3) - see: Ketene acetal
  CH2=CH-MgBr - see: Vinyl-MgX
  CH2=CH-OR - see: Vinyl-OR
  CH2=CH-X - see: Vinyl-X
  CH2=CHCH2-X - see: Allyl-X
  CH2=N2 - see: Diazomethane
  CH2=NMe2+I-: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  CH2=O - see: Formaldehyde
  CH2Br2: 1, 2, 3, 4, 5
  CH2Br2, Zn°, TiCl4: 1, 2, 3
  CH2I2: 1, 2
  CH2I2, Sm: 1
  CH2I2, Zn°, ZrCl4: 1
  CH2I2, Zn/Ag: 1
  CH2I2, Zn/Cu: 1, 2, 3, 4, 5
  CH2I2, ZnEt2: 1, 2, 3, 4, 5
  CH3CO2H - see: Acetic acid
  CHBr3: 1, 2
  CHI3: 1, 2, 3, 4, 5, 6
  Chiral auxiliary: 1, 2, 3, 4, 5, 6, 7, 8
  Chiral auxiliary-Boronate: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29
  Chiral auxiliary-Evans: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14
  Chiral auxiliary-Ketal: 1, 2
  Chiral auxiliary-Misc: 1, 2, 3
  Chiral auxiliary-Myers: 1, 2
  Chiral auxiliary-SAMP: 1, 2
  Chiral auxiliary-Sulfox: 1, 2
  Chiral base: 1, 2, 3
  Chiral catalyst: 1, 2
  Chiral catalyst (amine): 1, 2, 3, 4
  Chiral catalyst (amino-acid): 1, 2
  Chiral catalyst (amino-alcohol): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  Chiral catalyst (diamine): 1, 2, 3, 4
  Chiral catalyst (diol): 1, 2, 3, 4, 5, 6, 7
  Chiral catalyst (imidazolone): 1, 2
  Chiral catalyst (phosphine): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14
  Chloral: 1
  Chloramine T - see: TsNClNa
  Chloride - see: AlCl3; AlEt2-Cl; AlEtCl2; CuCl; CdCl2; BCl3; CrCl2; FeCl3; HgCl2; HfCl2; RhCl3; RuCl3; SbCl5; SnCl4; TiCl4; ZnCl2; etc
  Chloride, ammonium: 1, 2, 3, 4, 5, 6, 7
  Chloride, calcium: 1, 2, 3
  Chloride, lithium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21
  Chloride, R4N+: 1, 2
  Chloride, sodium: 1, 2, 3, 4
  Chlorite, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  Chloroacetate: 1, 2, 3, 4, 5
  Chlorocarbonate - see: O=C(OR)Cl
  Chloroethyl chloroformate - see: O=C(OR)Cl
  Chloroformate - see: O=C(OR)Cl
  Chloromethyl ether: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22
  Cinchonidine: 1
  Citric acid: 1, 2, 3
  Cl-CH2CO2R - see: Chloroacetate
  Cl-CH2OR - see: Chloromethyl ether
  Cl-CO2R - see: O=C(OR)Cl
  Cl2: 1, 2, 3, 4
  Cl2C=O - see: O=CCl2
  Cl2CH-OMe: 1, 2
  Cl3C-CCl3: 1
  CO: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  CO - see: PdX2, CO
  CO/H2: 1
  CO2: 1, 2, 3, 4, 5, 6, 7, 8
  COCl2 - see: O=CCl2
  CoCp(CO)2: 1
  Collidine: 1, 2, 3, 4
  Comins reagent - see:Tf2N-2-Py-5-Cl
  Cooke dianion: 1
  Corey diazaborolidine: 1, 2, 3
  Corey oxazaborolidine: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Corey-Kim - see: Me2S·Cl2
  Cp2ZrClH - see: ZrCp2ClH
  CpCo(CO)2 - see: CoCp(CO)2
  Cr(CO)6 - see: BuOOH, Cr(CO)6
  Cr2O7·2ImH: 1
  Cr2O7·2PyH (PDC): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26
  Crabtree catalyst: 1, 2, 3
  CrCl2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  CrO3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  CrO3·Py2 (Collins): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31
  CrO3, DMP: 1
  CrO3, H2SO4 (Jones): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53
  CrO3Cl·PyH (PCC): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42
  CrO4Na2: 1, 2
  Crotonaldehyde: 1, 2, 3, 4, 5, 6, 7, 8
  Crotonate: 1, 2, 3, 4, 5
  Crotyl - see: Allyl
  Crotyl-B(Ipc)2: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Crotyl-B(tartrate): 1, 2, 3, 4, 5, 6
  Crotyl-MgX: 1
  Crotyl-SnR3: 1
  Crown - see: 18-cr-6
  CS2: 1, 2, 3, 4, 5, 6, 7
  Cs2CO3 - see: Carbonate, cesium
  CSA - see: Camphor sulfonic acid
  CsF - see: Fluoride, cesium
  CsOAc - see: Acetate, cesium
  CsOBz - see: Benzoate, cesium
  CsOH - see: Hydroxide, cesium
  Cu(acac)2: 1
  Cu(COD)Cl: 1
  Cu(OAc)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Cu(OTf)2: 1, 2, 3, 4, 5
  CuBr: 1, 2, 3, 4
  CuBr·SMe2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  CuCl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  CuCl2: 1, 2, 3, 4, 5
  CuCN: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  CuH: 1
  CuI: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44
  CuI·PBu3: 1, 2, 3
  CuI·SMe2: 1, 2
  Cumene: 1
  CuO: 1, 2, 3
  CuOC(O)R: 1
  CuOTf: 1, 2, 3
  Cuprate - see: LiCuMe2; LiCuEt2; Vinyl-Cu; Allyl-Cu; Cu salts; Keywords - Cu-R
  CuSiR3: 1, 2
  CuSO4: 1, 2, 3, 4
  CuSPh: 1, 2
  Cyanide, AlR2: 1, 2, 3, 4, 5
  Cyanide, potassium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  Cyanide, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  Cyanide, trimethylsilyl: 1, 2, 3, 4, 5, 6, 7, 8
  Cyanide, zinc: 1
  Cyanoborohydride - see: BH3CN-Na+
  Cyanuric chloride: 1
  Cyanuric fluoride: 1
  Cyclohexadiene: 1, 2
  Cyclopentadiene: 1, 2, 3, 4, 5, 6
  Cyclopentadienide: 1, 2, 3
  Danishefsky diene: 1, 2
  DBN: 1, 2, 3
  DBU: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56
  DCC - see: Carbodiimide
  DDQ: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37
  DEAD: 1, 2, 3
  DEAD - see: PBu3, DEAD; PPh3, DEAD
  Dess-Martin: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96
  DHP: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  DIAD: 1, 2
  Diazoacetate: 1, 2, 3, 4
  Diazoethane: 1
  Diazoketone: 1, 2, 3, 4
  Diazomethane: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45
  Diazomethane, silyl: 1, 2, 3, 4, 5, 6
  Diazophosphonate: 1, 2, 3, 4, 5, 6, 7, 8, 9
  DIBALH - see: AlHiBu2
  Diboron pinacolate - see: B2(Pinacol)2
  Dichromate - see: Cr2O7
  Diimide: 1, 2, 3, 4, 5
  Diisopinocampheylborane - see: BH(Ipc)2, Allyl-B(Ipc)2; Crotyl-B(Ipc)2
  Dimethoxypropane - see: Me2C(OMe)2
  Dimethyl carbonate - see: O=C(OR)2
  Dimethyl dioxirane - see: Dioxirane
  Dimethyl sulfate - see: Me2SO4
  Dimsyl sodium - see: NaCH2S(O)CH3
  Dioxirane: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14
  DIPEA - see: NEtiPr2
  Diphenyl diselenide - see: Diselenide, phenyl
  DIPT: 1, 2, 3
  Diselenide, phenyl: 1, 2, 3, 4, 5, 6
  Disiamyl borane - see: BH(Siam)2
  Disulfide, methyl: 1
  Disulfide, phenyl: 1, 2, 3, 4
  Disulfide, pyridyl: 1
  Ditelluride, phenyl: 1
  Dithionite, sodium: 1
  DMAP: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67
  DMAP - see: Acetic anhydride, DMAP
  DMDO - see: Dioxirane
  DMF (react): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  DMF (solvent): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64
  DMF dimethylacetal: 1, 2
  DMP - see: Dess-Martin
  DMPU (solvent): 1, 2, 3, 4, 5, 6, 7, 8, 9
  DMSO (solvent): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52
  DMSO, (CF3CO)2O: 1, 2, 3, 4, 5
  DMSO, (COCl)2 (Swern): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83
  DMSO, Ac2O (Moffat): 1
  DMSO, carbodiimide (Pfitzner–Moffatt): 1, 2, 3
  DMSO, CF3CO2H (Moffat): 1, 2
  DMSO, Py·SO3 (Parikh-Doering): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  Dowex: 1, 2
  DPPA - see: Azide, diphenylphosphoryl
  EDCI - see: Carbodiimide
  Electrolysis: 1, 2, 3
  Ellman reagent - see: Sulfinamide
  EneNitro: 1, 2
  EnePhosphonate: 1, 2
  EnePhosphonium: 1
  EneSulfide: 1, 2, 3, 4, 5, 6, 7, 8
  EneSulfone: 1, 2, 3, 4
  EneSulfoxide: 1, 2, 3, 4
  Enol acetate - see: Vinyl-OAc
  Enol ether - see: Vinyl-OR
  Enzyme: 1, 2
  Ephedrine: 1, 2
  Epoxide: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67
  Eschenmoser salt - see: CH2=NMe2+I-
  Et2iPrSi-OTf - see: SiEt2iPr-OTf
  Et2C(OMe)2: 1
  Et2NH - see: NHEt2
  Et2SO4 - see: Sulfate, diethyl
  Et3Al - see: AlEt3
  Et3O+ X-: 1, 2
  Et3Si-X - see: SiEt3-X
  Et3SiH - see: HSiEt3
  Ethyl vinyl ketone: 1, 2, 3, 4, 5, 6
  Ethylene: 1
  Ethylene dibromide: 1, 2, 3, 4
  Ethylene dichloride: 1, 2
  Ethylene dithiol - see: Thiol, (CH2)2-SH
  Ethylene glycol - see: Glycol
  Ethylene oxide - see: Epoxide
  EtNPr2 - see: NEtiPr2
  Evans amide - see: Keywords - CarboxAmide(Evans); Amide enolate(Evans)
  EVK - see: Ethyl vinyl ketone
  Fe(acac)3: 1, 2
  Fe(CN)6K3: 1
  FeCl3: 1, 2, 3, 4, 5, 6, 7, 8
  Flash vacuum pyrolysis: 1, 2, 3, 4, 5
  Fluoride, ammonium: 1, 2, 3
  Fluoride, cesium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Fluoride, potassium: 1, 2, 3, 4
  Fluoride, R4N+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135
  Formaldehyde: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55
  Formamide - see: DMF
  Formate, ammonium: 1
  Formate, ethyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  Formate, methyl: 1, 2, 3, 4, 5, 6
  Formate, ortho - see: Orthoformate
  Formic acetic anhydride: 1, 2, 3, 4
  Formic acid: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31
  Formic acid - see: Pd, formic acid
  Furyl-Ce: 1
  Furyl-Li: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  FVP - see: Flash vacuum pyrolysis
  Glycol: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60
  Glycol, bistrimethylsilylether: 1, 2, 3
  Glyoxal: 1
  Glyoxalate: 1, 2, 3, 4, 5, 6
  Grignard - see: Alkyl-MgX, Alkynyl-MgX, Allyl-MgX, Aryl-MgX, Crotyl-MgX, EtMgX, MeMgX, Vinyl-MgX; Keywords - Mg-
  Grubbs I: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  Grubbs II: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27
  Grubbs-Hoveyda: 1, 2, 3, 4, 5, 6, 7, 8, 9
  hν - see: Photochemistry
  H2, cat: 1, 2, 3, 4, 5
  H2, Ir: 1, 2, 3, 4, 5, 6
  H2, Ni: 1, 2
  H2, Pd: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132
  H2, Pt: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31
  H2, RaNi: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  H2, Rh: 1, 2, 3, 4, 5
  H2CrO4 - see: CrO3, H2SO4
  H2NNH2 see: Hydrazine
  H2NOH - see: NH2OH
  H2O2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64
  H2O2, K2CO3: 1, 2
  H2O2, KHCO3: 1
  H2O2, KOtBu: 1
  H2O2, KOH: 1, 2
  H2O2, LiOH: 1
  H2O2, Mo: 1, 2, 3, 4, 5, 6, 7
  H2O2, NaHCO3: 1, 2
  H2O2, NaOH: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45
  H2O2, W: 1
  H2SiF6: 1, 2, 3
  H2SO4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38
  H3PO4: 1, 2
  H5IO6 - see: Periodic acid
  Hagemann's ester: 1, 2
  HAliBu2 - see: AlHiBu2
  HATU: 1, 2, 3
  HBF4: 1, 2, 3
  HBr: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  HBTU: 1, 2, 3
  HC≡C-Li - see: Alkynyl-Li
  HC≡C-MgX - see: Alkynyl-MgX
  HC(OEt)3 - see: Orthoformate
  HC(OMe)2NMe2 - see: DMF dimethylacetal
  HCl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75
  HCl, AcOH: 1, 2, 3
  HCl, EtOH: 1, 2, 3, 4, 5, 6
  HCl, H2O: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92
  HCl, MeOH: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32
  HCl, THF: 1, 2, 3, 4, 5, 6, 7
  HClO4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  HCN: 1, 2, 3
  HCO2H - see: Formic acid
  HCONMe2 - see: DMF
  Hexafluoroisopropanol (solvent): 1, 2, 3
  HF: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27
  HF·NEt3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  HF·Py: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24
  HfCl2: 1
  HfCp2HCl: 1
  Hg(ClO4)2: 1, 2, 3, 4
  Hg(OAc)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  Hg(OTFA)2: 1
  HgCl2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  HgO: 1, 2, 3, 4, 5, 6
  HgSO4: 1
  HI: 1, 2, 3, 4
  High pressure: 1, 2, 3, 4, 5
  HIO4 - see: Periodic acid
  HMDS - see: NH(SiMe3)2; NaN(SiMe3)2; LiN(SiMe3)2
  HMPA (solvent): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82
  HMPA - see: BuLi(n), HMPA; BuLi(tert), HMPA; LiNiPr2, HMPA
  HN(SiMe3)2 - see: NH(SiMe3)2
  HN=NH - see: Diimide
  HOAc - see: Acetic acid
  HOBt: 1
  HSi(SiMe3)3: 1, 2
  HSiEt3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  HSiEt3, Pd: 1, 2, 3
  HSiH2Ph: 1
  HSiMe2(OEt): 1
  HSiMe2-O-SiMe2H: 1
  HSiPh3: 1
  HSiPhH2: 1, 2, 3, 4, 5, 6, 7
  HSntBu3: 1
  HSnBu2H: 1
  HSnBu3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55
  HSnPh3: 1, 2, 3
  HSR - see: Thiol
  Hunig's base - see: NEtiPr2
  Hydrazine: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27
  Hydrazine, p-nitrophenylsulfonyl: 1
  Hydrazine, phenyl: 1, 2, 3, 4, 5, 6, 7, 8
  Hydrazine, tosyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  Hydrobenzoin: 1
  Hydrochloric acid - see: HCl
  Hydrogen - see: H2
  Hydrogen peroxide - see:H2O2
  Hydroperoxide, tbutyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20
  Hydroperoxide, tbutyl - Cr: 1
  Hydroperoxide, tbutyl - Mo: 1
  Hydroperoxide, tbutyl - V: 1, 2, 3, 4, 5, 6, 7, 8
  Hydroperoxide, tbutyl - Ti: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  Hydroperoxide, trityl: 1, 2, 3
  Hydroquinone: 1
  Hydrosulfite - see: Dithionite, sodium
  Hydroxide, barium: 1, 2, 3, 4, 5, 6
  Hydroxide, cesium: 1
  Hydroxide, lithium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33
  Hydroxide, potassium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96
  Hydroxide, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76
  Hydroxylamine - see: NH2OH
  Hydroxylamine, O,N-dimethyl - see: NMe(OMe)-R
  Hypochlorite, tbutyl: 1, 2, 3
  Hypochlorite, potassium: 1
  Hypochlorite, sodium: 1, 2, 3
  I-CH2CO2R - see: Iodoacetate
  I2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52
  I2, KI: 1, 2, 3, 4, 5
  I2, NaHCO3: 1, 2, 3, 4, 5, 6
  I2, PPh3 - see: PPh3, I2
  I2, Py: 1
  IBr: 1, 2, 3
  IBX: 1, 2, 3, 4, 5, 6, 7
  ICl: 1, 2, 3, 4
  Im2C=O - see: O=C(Imid)2
  Im2C=S - see: S=C(Imid)2
  Imidazole: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68
  In°: 1, 2
  InCl3: 1
  InHCl2: 1
  IO4- - see: Periodate
  Iodide, ammonium: 1
  Iodide, lithium: 1, 2, 3, 4
  Iodide, potassium: 1, 2
  Iodide, R4N+: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  Iodide, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33
  Iodoacetate: 1, 2, 3
  Iodoethanol: 1
  Iodoform - see: CHI3
  Iodonium ylide: 1
  Iodosobenzene: 1, 2
  Iodosobenzene-cyanotriflate: 1, 2
  Iodosobenzene-OAc: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Iodosobenzene-TFA: 1, 2, 3, 4, 5
  Ipc2B-X - see: BX(Ipc)2
  Ir(COD)X: 1
  Isocyanate: 1, 2, 3, 4, 5, 6, 7, 8
  Isocyanide: 1
  Jones reagent - see: CrO3, H2SO4
  K-Selectride - see: BH(sBu3)-K+
  K2CO3 - see: Carbonate, potassium
  K2OsO4 - see: OsO4-22K+
  KBHsBu3 - see: BH(sBu3)-K+
  KCN - see: Cyanide, potassium
  Ketene: 1, 2
  Ketene acetal: 1, 2, 3, 4, 5, 6
  Ketene acetal - see: Keywords: Claisen-Ireland
  Ketene dimer: 1, 2
  Ketene, trimethylsilyl: 1
  KF -see: Fluoride, potassium
  KH: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  KHF2 - see: Bifluoride, potassium
  KHMDS - see: KN(SiMe3)2
  KHSO4 - see: Bisulfate, potassium
  KI - see: Iodide, potassium
  KIO4 - see: Periodate, potassium
  KMnO4 - see: Permanganate, potassium
  KN(SiMe3)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47
  KOtAm: 1, 2, 3, 4, 5
  KOtBu: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81
  KOAc - see: Acetate, potassium
  KOCl - see: Hypochlorite, potassium
  KOH - see: Hydroxide, potassium
  KSR - see: Thiolate
  L-Selectride - see: BH(sBu3)-Li+
  LaCl3: 1, 2, 3
  Lactaldehyde: 1
  LAH - see: AlH4-Li+
  Lawesson: 1, 2, 3, 4
  LDA - see: LiNiPr2
  Lead tetraacetate - see: Pb(OAc)4
  LHMDS - see: LiN(SiMe3)2
  Li°/EtNH2: 1, 2, 3, 4
  Li°/H2NCH2CH2NH2: 1, 2
  Li°/MeNH2: 1, 2
  Li°/Naphth: 1, 2, 3, 4, 5, 6
  Li°/NH3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61
  Li°/THF: 1
  Li-Dithiane - see: Keywords index
  Li2CO3 - see: Carbonate, lithium
  LiAlH(OtBu)3 - see: AlH(OtBu)3-Li+
  LiAlH4 - see: AlH4-Li+
  LiAr - see: Aryl-Li; Furyl-Li; Mesityl-Li; Pyridyl-Li
  LiBF4: 1, 2, 3
  LiBH3NH2 - see: BH3NH2-Li+
  LiBH4 - see: BH4-Li+
  LiBHsBu3 - see: BH(sBu3)-Li+
  LiBHEt3 - see: BH(Et)3-Li+
  LiBr - see: Bromide, lithium
  LiC≡CR - see: Alkynyl-Li
  LiC(SR)3: 1, 2
  LiCH(SR)2: 1
  LiCH(SR)2 - see: Keywords - Li-Dithiane
  LiCH2-Cl: 1
  LiCH2-CN: 1, 2
  LiCH2-N=CR2: 1, 2
  LiCH2-NC: 1
  LiCH2-OR: 1, 2, 3, 4, 5
  LiCH2-PO(OMe)2 - see: P(O)(OMe)2CH2-Li
  LiCH2-R - see: Alkyl-Li
  LiCH2-SePh: 1
  LiCH2-SiR3: 1, 2, 3
  LiCH2-SPh: 1
  LiCH2-Sulfinyl: 1
  LiCH2-Sulfonyl: 1, 2
  LiCH=CH2 - see: Vinyl-Li
  LiCHBr2: 1, 2, 3
  LiCHCl2: 1, 2, 3, 4, 5, 6, 7, 8
  LiCHMe2: 1
  LiCHR-OR: 1
  LiCHR-PPh2: 1
  LiCHR-SPh: 1
  LiCHR-Sulfinyl: 1
  LiCHR-Sulfonyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  LiCl - see: Chloride, lithium
  LiClO4: 1, 2, 3, 4
  LiCPh3: 1, 2
  LiCuEt2: 1, 2
  LiCuMe2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41
  LiDBB: 1, 2, 3, 4
  LiHMDS - see: LiN(SiMe3)2
  LiI - see: Iodide, lithium
  LiMe - see: MeLi
  LiN(OMe)Me: 1, 2
  LiN(Phenethyl)R: 1, 2, 3
  LiN(SiMe2Ph)2: 1
  LiN(SiMe3)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62
  LiNiPr2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152, 153, 154, 155, 156, 157, 158, 159, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 174, 175, 176, 177, 178, 179, 180, 181, 182, 183, 184, 185, 186, 187, 188, 189, 190, 191, 192, 193, 194, 195, 196, 197
  LiNiPr2, HMPA: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  LiNiPrCy: 1, 2, 3, 4, 5, 6, 7
  Lindlar - see: Keywords - Alkyne -> Ene-cis (Lindlar)
  LiNEt2: 1, 2, 3, 4, 5, 6
  LiOtBu: 1, 2, 3, 4
  LiOCH2Ph: 1, 2
  LiOH - see: Hydroxide, lithium
  LiOMe: 1
  Lipase: 1, 2, 3, 4
  LiSiR3: 1, 2, 3, 4
  LiSiR3 - see: CuSiR3
  LiSnR3: 1, 2, 3, 4
  LiSR - see: Thiolate
  Lithium acetylide - see: Alkynyl-Li
  LiTMP: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Luche - see: BH4-Na, CeCl3
  Lutidine: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29
  Maleic anhydride: 1, 2, 3, 4, 5, 6, 7
  Malonate: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22
  Mander reagent - see: O=C(OR)CN
  Martin sulfurane: 1, 2, 3, 4, 5
  MCPBA - see: Perbenzoic acid, 3-chloro
  Me-C≡C-Li - see: Alkynyl-Li
  Me2tBuSi-X - see: SiMe2tBu-X
  Me2Al-CN - see: Cyanide, AlR2
  Me2Al-NMe(OMe) - see: NMe(OMe)-AlMe2
  Me2BBr - see: BBrMe2
  Me2C(OMe)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  Me2C=O - see: Acetone
  Me2NCH(OMe)2 - see: DMF dimethylacetal
  Me2NH - see: NHMe2
  Me2S: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21
  Me2S - see: O3
  Me2S·Cl2: 1
  Me2S(O)=CH2: 1
  Me2S-SMe+ X-: 1, 2, 3
  Me2S=CH2: 1, 2
  Me2SO4 - see: Sulfate, dimethyl
  Me3Al - see: AlMe3
  Me3CCOCl - see: Piv-Cl
  Me3NO - see: NMe3(O)
  Me3O+ X-: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Me3S+ I-: 1
  Me3Si-CN - see: Cyanide, trimethylsilyl
  Me3Si-N3 - see: Azide, trimethylsilyl
  Me3Si-SePh - see: SePh-SiMe3
  Me3Si-SnBu3 - see: SnBu3-SiMe3
  Me3Si-X - see: SiMe3-X
  Me3SiC≡CH - see: Alkynyl-SiR3
  Me3SiCH2-Li - see: LiCH2-SiMe3
  Me3SiCH2CO2Me - see: SiMe3-CH2CO2Me
  Me3SiCH=N2 - see: Diazomethane, silyl
  Me3Sn-Li - see: LiSnR3
  Me3Sn-X - see: SnMe3-X
  Me3SnSnMe3 - see: SnMe3-SnMe3
  Me3SO+ I-: 1
  Me4N+ BH(OAc)3- - see: BH(OAc)3-Me4N+
  MeB(OH)2 - see: BMe(OH)2
  Meerwein reagent - see: Et3O+ X-
  Meerwein salt - see: Me3O+ BF4-
  MeI: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108
  MeLi: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67
  MEM-Cl: 1, 2, 3, 4, 5
  MeMgBr: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27
  MeMgCl: 1, 2, 3, 4, 5, 6, 7
  MeMgI: 1, 2, 3, 4, 5
  MeNH3Cl - see: NH2Me
  MeNO2: 1, 2, 3, 4
  Menthol: 1, 2
  MeOCH2Cl - see: Cl-CH2-OR
  MeOMs: 1
  MeONa - see: NaOMe
  MeOSO2F: 1, 2, 3, 4
  MeOTf: 1, 2, 3, 4, 5, 6, 7, 8, 9
  MeOTs: 1, 2
  Mercaptopyridine-N-oxide: 1
  MeSeAlMe2 - see: SeMe-AlMe2
  Mesityl-Li: 1, 2, 3
  MeSO2Cl - see: Sulfonyl chloride, methane
  MeSSMe - see: Disulfide, methyl
  Methacrolein: 1, 2
  Methacrylate: 1, 2
  Methallyl-Br - see: Allyl-Br
  Methallyl-Cl - see: Allyl-Cl
  Methanesulfonic - see: Sulfonic, Sulfonyl
  Methyl vinyl ketone: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  Methylene bromide - see: CH2Br2
  Mg°: 1, 2, 3, 4, 5, 6
  Mg(ClO4)2: 1, 2
  Mg(Hg): 1
  Mg(OMe)2: 1
  MgBr2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  MgCH2-SiMe3: 1, 2, 3
  MgCl2: 1, 2, 3
  MgI2: 1
  MgSO4 - see: Sulfate, magnesium
  Microbial oxidation: 1
  Microwave: 1, 2, 3, 4, 5, 6
  Mn(OAc)3: 1
  MnO2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40
  MnO4- M+ - see: Permanganate
  Mo(CO)6: 1, 2
  Mo7O24(NH4)6: 1
  MOM-Cl - see: Cl-CH2-OR
  Montmorillonite: 1
  MoOPH: 1, 2, 3, 4, 5
  Morpholine: 1, 2, 3, 4, 5
  Morpholine - see: NMO; OsO4, NMO; RuO4-Pr4N+, NMO
  MsCl - see: Sulfonyl chloride, methane
  MVK - see: Methyl vinyl ketone
  Na°: 1
  Na°, ROH: 1, 2
  Na°/Naphth: 1, 2, 3, 4
  Na°/NH3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  Na(Hg): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  Na/K: 1
  Na2CO3 - see: Carbonate, sodium
  Na2HPO4: 1
  Na2S - see: Sulfide, sodium
  Na2S2O4 - see: Dithionite, sodium
  Na2SO4 - see: Sulfate, sodium
  NaAlH2(OR)2 - see: AlH2(OR)2-Na+
  NaBH3CN - see: BH3CN-Na+
  NaBO3: 1, 2, 3
  NaCH2S(O}CH3: 1
  NaCl - see: Chloride, sodium
  NaClO2 - see: Chlorite, sodium
  NaCN - see: Cyanide, sodium
  NaCPh3: 1, 2
  NaH: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152
  NaHCO3 - see: Bicarbonate, sodium
  NaHSO4 - see: Bisulfate, sodium
  NaI - see: Iodide, sodium
  NaIO4 - see: Periodate, sodium; OsO4, NaIO4
  NaN(SiEt3)2: 1
  NaN(SiMe3)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27
  NaN3 - see: Azide, sodium
  NaNH2: 1, 2, 3, 4, 5, 6
  NaNO2 - see: Nitrite, sodium
  NaOtAm: 1
  NaOtBu: 1, 2, 3, 4
  NaOAc - see: Acetate, sodium
  NaOBn: 1
  NaOCl - see: Hypochlorite, sodium
  NaOEt: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  NaOH - see: Hydroxide, sodium
  NaOMe: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64
  NaSePh - see: Selenolate, phenyl
  NaSi(NMe2)3: 1
  NaSR - see: Thiolate
  NBn(OH)H: 1
  NBS: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43
  NBu3: 1, 2, 3
  NC-CCl3 - see: Acetonitrile, trichloro
  NC-CO2R - see: O=C(OR)CN
  NCS: 1, 2, 3, 4, 5, 6
  NEt3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118
  NEtiPr2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44
  NH(SiMe3)2 (HMDS): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  NH2tBu: 1
  NH2Bn: 1, 2, 3, 4
  NH2CHPh2: 1
  NH2Me: 1, 2, 3, 4, 5, 6, 7, 8, 9
  NH2NH2 - see: Hydrazine
  NH2OH: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20
  NH2OMe: 1, 2
  NH2Pr: 1, 2
  NH3: 1, 2, 3, 4, 5, 6, 7
  NH3 - see: Li/NH3; Na/NH3; Ca/NH3
  NH4+ X- - see: Chloride, ammonium; Formate, ammonium; Iodide, ammonium; Fluoride, ammonium; Acetate, ammonium
  NHiPr2: 1, 2, 3, 4, 5
  NHBoc2: 1
  NHEt2: 1, 2
  NHMe2: 1, 2, 3, 4, 5, 6, 7
  NHMePh: 1
  NHTf2 - see: Tf2NH
  Ni(acac)2: 1
  Ni(cod)2: 1, 2, 3, 4, 5, 6
  Ni(dppp)Cl2: 1
  NiB: 1
  NiBr: 1
  NiBr(Allyl): 1
  NiCl2: 1, 2, 3, 4, 5, 6, 7, 8
  NIS: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  Nitrite, sodium: 1, 2, 3, 4, 5, 6
  Nitrosobenzene: 1
  NMe(OH)-H: 1
  NMe(OMe)-AlMe2: 1, 2, 3, 4, 5, 6, 7, 8
  NMe(OMe)-H: 1, 2, 3, 4, 5, 6, 7, 8, 9
  NMe(OMe)-Li - see: LiN(OMe)Me
  NMe2Et: 1
  NMe3(O): 1, 2, 3
  NMeBn-H: 1
  NMO: 1, 2, 3, 4, 5, 6
  NMO - see: RuO4-Pr4N+
  Noyori catalyst: 1
  Nozaki-Takai - see: CH2Br2, Zn, TiCl4
  O2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36
  O2 (singlet): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  O2, PtO2: 1, 2, 3
  O3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85
  O=C(CO2Me)Cl: 1, 2
  O=C(Imid)2: 1, 2, 3, 4, 5, 6, 7
  O=C(NMe2)H - see: DMF
  O=C(NR2)Cl: 1, 2
  O=C(OAllyl)Cl: 1, 2, 3
  O=C(OR)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14
  O=C(OR)Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31
  O=C(OR)CN: 1, 2, 3, 4, 5, 6, 7, 8, 9
  O=C(SR)Cl: 1
  O=C=O - see: CO2
  O=CCl2: 1, 2, 3
  O=CH2 - see: Formaldehyde
  O=CHOR - see: Formate
  O=CPh2 - see: Benzophenone
  O=P(NMe2)3 - see: HMPA
  O=SMe2 - see: DMSO
  Orthoacetate: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Orthoester: 1
  Orthoformate: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26
  OsO4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30
  OsO4, KClO3: 1
  OsO4, NaIO4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  OsO4, NMO: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29
  OsO4-22K+: 1, 2, 3
  Oxalate: 1, 2, 3
  Oxalic acid: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Oxalyl chloride: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27
  Oxalyl chloride - see: DMSO, (COCl)2; O=C(CO2Me)Cl
  Oxazaborolidine - see: Corey oxazaborolidine
  Oxaziridine: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  Oxaziridine, Camphor: 1, 2
  Oxetane: 1, 2
  Oxirane - see: Epoxide
  Oxone: 1, 2, 3
  Oxygen - see: O2
  Ozone - see: O3
  P°(red): 1
  P(O)(NMe2)2Cl: 1
  P(O)(OCH2CF3)2CH2-CO2Me: 1, 2, 3, 4, 5
  P(O)(OCH2CF3)2CHR-C(O)Me: 1
  P(O)(OCH2CF3)2CHR-CO2Me: 1, 2, 3, 4
  P(O)(OMe)2CH2-Li: 1
  P(O)(OPh)2N3 see: - see: Azide, diphenylphosphoryl
  P(O)(OR)2CH2-Alkyl: 1
  P(O)(OR)2CH2-Ar: 1, 2
  P(O)(OR)2CH2-C(O)Cl: 1
  P(O)(OR)2CH2-C(O)OR': 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  P(O)(OR)2CH2-C(O)R': 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  P(O)(OR)2CH2-NR'2: 1
  P(O)(OR)2CH2-SR': 1, 2, 3, 4
  P(O)(OR)2CH2-Vinyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  P(O)(OR)2CH=N2 - see: Diazophosphonate
  P(O)(OR)2CHR-C(O)OR': 1
  P(O)(OR)2CHR-C(O)R': 1, 2, 3, 4
  P(O)(OR)2Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  P(O)NMe2Cl2: 1
  P(O)Ph2CH2-R: 1, 2, 3
  P(Oct)3: 1
  P(OEt)2Cl: 1
  P(OEt)3: 1, 2, 3, 4, 5
  P(OMe)3: 1, 2, 3, 4, 5
  P(Tol)3: 1
  P4 - see: Phosphazene base
  P2O5: 1, 2, 3, 4
  Paraformaldehyde - see: Formaldehyde
  Parikh-Doering - see: DMSO, Py·SO3
  Pb(O2CCF3)4: 1
  Pb(OAc)2: 1
  Pb(OAc)4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12
  PbCl2: 1
  PBr3: 1, 2, 3, 4, 5, 6
  PBu3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21
  PBu3, CCl4: 1
  PBu3, DEAD: 1, 2, 3
  PCC - see: CrO3Cl·PyH
  PCy3: 1
  Pd°: 1, 2
  Pd(dmdba)2: 1
  Pd(OAc)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45
  Pd(OTFA)2: 1
  Pd(OTFA)2(PPh3)2: 1
  Pd(PtBu3)2: 1
  Pd(PPh3)4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62
  Pd(PPh3)4, CO: 1
  Pd, formic acid: 1, 2
  Pd/C: 1, 2, 3, 4, 5, 6
  Pd/C - see: H2, Pd; HCOOH, Pd; HSiEt3, Pd
  Pd2(dba)3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21
  PDC - see: Cr2O7·PyH
  PdCl(Allyl): 1, 2, 3, 4, 5
  PdCl2: 1, 2, 3, 4, 5, 6, 7, 8, 9
  PdCl2(dppf): 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  PdCl2(MeCN)2: 1, 2, 3, 4, 5, 6
  PdCl2(PPh3)2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  Peracetic acid: 1, 2, 3
  Peracetic acid, trifluoro: 1, 2, 3, 4
  Perbenzoic acid: 1
  Perbenzoic acid, 2,4-dinitro: 1
  Perbenzoic acid, 3,5-dinitro: 1, 2, 3
  Perbenzoic acid, 3-chloro: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110
  Perbromide - see: Tribromide
  Perchloric acid - see: HClO4
  Periodate: 1
  Periodate, potassium: 1
  Periodate, R4N+: 1, 2
  Periodate, sodium: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64
  Periodic acid: 1, 2, 3, 4, 5
  Permanganate, barium: 1, 2, 3
  Permanganate, potassium: 1, 2
  Permanganate, silver: 1
  Peroxidation - see: Keywords - Epoxidation
  Peroxide - see: H2O2; Hydroperoxide, trityl; Hydroperoxide, tbutyl; Peracid
  Perphthalic acid: 1
  Perruthenate - see: RuO4-Pr4N+
  Pertrifluoroacetic acid - see: Peracetic acid, trifluoro
  Petasis - see: TiCp2Me2
  Pfitzner-Moffat - see: DMSO, carbodiimide
  Ph2tBuSi-X - see: SiPh2tBu-X
  Ph3C+ClO4-: 1
  Ph3CCl: 1, 2, 3, 4
  Ph3CNa - see: NaCPh3
  Ph3COOH - see: Hydroperoxide, trityl
  Ph3P·Br2 - see: PPh3, Br2
  Ph3P, CBr4 - see: PPh3=CBr2; PPh3, CBr4
  Ph3P=CR2 - see: PPh3=CR2
  Ph3SnH - see: HSnPh3
  PhB(OH)2: 1
  PhCO3H - see: Perbenzoic acid
  PhCOCl - see: Benzoyl chloride
  Phenylselenoacetaldehyde: 1
  PhHgCBr3: 1
  PhI(CN)OTf - see: Iodosobenzene-cyanotriflate
  PhI(O2CCF3)2 - see: Iodosobenzene-TFA
  PhI(OAc)2 - see: Iodosobenzene-OAc
  PhIO - see: Iodosobenzene
  PhLi: 1, 2, 3
  PhMgBr - see: Aryl-MgX
  PhN=O - see: Nitrosobenzene
  PhNCO - see: Isocyanate
  PhNTf2 - see: Tf2NPh
  Phosgene - see: O=CCl2; Triphosgene
  Phosphazene base: 1
  Phosphonate - see: P(O)
  Phosphonium ylids - see: PPh3=CR2; Keywords - Wittig
  Photochemistry: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28
  PHOX: 1
  PhSCl - see: SPh-Cl
  PhSe(O)Cl - see: Se(O)Ph-Cl
  PhSeCH2Li - see: LiCH2-SePh
  PhSeCl - see: SePh-Cl
  PhSeNa - see: Selenolate, phenyl
  PhSePhthalimide - see: SePh-Phthalimide
  PhSeSePh - see: Diselenide, phenyl
  PhSeSiMe3 - see: SePh-SiMe3
  PhSH - see: Thiol, phenyl
  PhSiH3 - see: HSiPhH2
  PhSNa - see: Thiolate, phenyl
  PhSO2C - see: Sulfonyl chloride, benzene
  PhSO2H see: Sulfinic acid, benzene
  PhSO2Na - see: Sulfinate, benzene
  PhSSPh - see: Disulfide, phenyl
  PhTeTePh - see: Ditelluride, phenyl
  Piperidine, pentamethyl: 1, 2, 3
  Piv-Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Piv-OH: 1
  PMB-Cl: 1, 2
  PMBO-C(=NH)-CCl3: 1, 2, 3, 4, 5, 6
  PMe3: 1, 2
  POBr3: 1
  POCl3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  Polyphosphoric acid: 1, 2, 3, 4, 5, 6
  Potassium - see: K
  PPA - see: Polyphosphoric acid
  PPh3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43
  PPh3, Br2: 1, 2
  PPh3, CBr4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  PPh3, DEAD: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30
  PPh3, DIAD: 1, 2, 3, 4, 5, 6
  PPh3, I2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  PPh3=C(Me)-C(O)R: 1, 2, 3, 4
  PPh3=C(Me)-CO2R: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  PPh3=C=C=O: 1, 2, 3
  PPh3=C=CHOR: 1
  PPh3=CBr2: 1, 2, 3, 4, 5, 6, 7
  PPh3=CH-Alkyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13
  PPh3=CH-Alkynyl: 1
  PPh3=CH-Ar: 1
  PPh3=CH-C(O)SEt: 1, 2
  PPh3=CH-CO2R: 1, 2, 3, 4, 5
  PPh3=CH-COMe: 1, 2
  PPh3=CH-I: 1, 2, 3
  PPh3=CH-Me: 1, 2, 3, 4, 5, 6, 7, 8
  PPh3=CH-OR: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  PPh3=CH-Vinyl: 1, 2
  PPh3=CH2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63
  PPh3=CI(Me): 1
  PPh3=CMe2: 1, 2, 3, 4
  PPTS - see: TsOH·Py
  Pr2EtN - see: NEtiPr2
  Pr2NH - see: NHiPr2
  Pr3Si-X - see: SiiPr3-X
  Prolinal: 1
  Proline: 1, 2, 3, 4
  Propargyl-Br: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Propargyl-I: 1, 2
  Propargyl-Li - see: Allenyl-Li
  Propargyl-MgX - see: Allenyl-MgX
  Propargyl-Se: 1
  Propargyl-Si: 1, 2, 3
  Propenyl-Br: 1
  Propenyl-Cu: 1
  Propenyl-Li: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Propenyl-MgX: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Propenyl-OR: 1, 2, 3, 4, 5
  Propenyl-ZnX: 1
  Propiolaldehyde: 1, 2, 3, 4, 5, 6, 7
  Propiolate: 1, 2, 3, 4, 5, 6, 7
  Propiolyl-Cl: 1
  Propionic acid: 1
  Propylene diamine: 1
  Propylene dithiol - see: HS(CH2)3SH
  Propyne: 1
  PrSNa - see: Thiolate
  Pseudoephedrine: 1, 2
  Pt - see: H2, Pt
  Pt(dba)3: 1
  PTAB - see: Tribromide
  Py·HOTs - see: TsOH·Py
  Py·SO3 - see: DMSO, Py·SO3
  PyH+ Br3- - see: Tribromide
  Pyridine: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  Pyridine, 2,6-di-tBu: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  Pyridinium, 2-halo: 1, 2, 3, 4, 5
  Pyridyl-Li: 1, 2, 3, 4, 5
  Pyrrolidine: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  Pyrrolyl-Li: 1, 2, 3, 4, 5, 6
  Pyrrolyl-MgX: 1
  PySSPy - see: Disulfide, pyridyl
  Quinone: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  RaNi: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  RaNi - see: H2, RaNi
  Rawal diene - see: Butadiene, 1-NR2
  Red-Al - see: AlH2(OR)2-Na+
  ReMeO3: 1
  Rh - see: H2, Rh
  Rh(CO)2acac: 1, 2
  Rh(CO)2Cl: 1, 2, 3
  Rh(COD)2OH: 1
  Rh(COD)Cl: 1
  Rh(PPh3)3Cl: 1, 2, 3, 4, 5
  Rh2(OAc)4: 1, 2, 3
  Rh2(OPiv)4: 1
  RhCl3: 1
  Ribose: 1
  Rose Bengal: 1, 2, 3
  Roush borane - see: Allyl-B(tartrate)
  Ru(COD)Cl: 1
  RuCl2(PPh3)2: 1
  RuCl3: 1, 2, 3, 4
  RuCp(NCMe)3PF6: 1, 2, 3
  RuO4: 1, 2, 3, 4, 5, 6
  RuO4-Pr4N+: 1, 2, 3, 4, 5
  RuO4-Pr4N+, NMO: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37
  S=C(Imid)2: 1, 2, 3, 4
  S=C(NH2)2: 1, 2
  S=C(NHBoc)2: 1
  S=C(OC6F5)Cl: 1
  S=C(OPh)Cl: 1, 2, 3, 4, 5
  S=C=S - see: CS2
  Salcomine: 1, 2, 3, 4, 5
  SbCl5: 1
  Sc(OTf)3: 1, 2, 3, 4, 5
  Schrock cat: 1, 2
  Se(O)Ph-Cl: 1
  Selectride - see: BH(sBu)3-Li+
  Selenenyl chloride - see: SePh-Cl
  Selenocyanate, o-nitrophenyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  Selenol, phenyl: 1
  Selenolate, o-nitrophenyl: 1, 2
  Selenolate, phenyl: 1, 2, 3, 4, 5, 6, 7
  SEM-Cl: 1, 2, 3, 4
  SeMe-AlMe2: 1
  SeO2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29
  SePh-Br: 1, 2, 3, 4, 5, 6
  SePh-Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24
  SePh-SePh - see: Diselenide, phenyl
  SePh-SeR2+: 1
  SePh-SiMe3: 1
  SiiPr3-Cl: 1, 2, 3
  SiiPr3-OTf: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  SiEt2iPr-OTf: 1
  SiEt3-Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25
  SiEt3-OTf: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  Sieves: 1, 2, 3, 4
  Silver - see: Ag
  Silyl hydride - see: HSiR3
  Silyl ketone: 1, 2, 3, 4
  Silyl triflate - see: SiEt3-OTf; SiMe3-OTf; SiiPr3-OTf; SiMe2tBu-OTf; SiPh2tBu-OTf
  SiMe2(CH2Br)-Cl: 1
  SiMe2tBu-Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69
  SiMe2tBu-OTf: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49
  SiMe2Ph-Li - see: LiSiR3
  SiMe3-Br: 1, 2
  SiMe3-CH2CO2Me: 1, 2
  SiMe3-CH2X: 1, 2, 3
  SiMe3-Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63
  SiMe3-CN - see: Cyanide, trimethylsily
  SiMe3-I: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  SiMe3-Im: 1, 2
  SiMe3-N3 - see: Azide, trimethylsilyl
  SiMe3-OTf: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22
  SiMe3-SePh - see: SePh-SiMe3
  SiMe3CH2-Li - see: LiCH2-SiMe3
  Simmons-Smith - see: CH2I2
  Simpkins' base - see: LiN(Phenethyl)2
  Singlet oxygen - see: O2 (singlet)
  SiO2: 1, 2, 3, 4
  SiPh2tBu-Cl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20
  SiPh2tBu-OTf: 1, 2
  SiPh3H - see: HSiPh3
  SMe2 - see: Me2S
  SmI2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  SnBu2(O): 1, 2, 3
  SnBu3-AlEt2: 1
  SnBu3-CH2-I: 1, 2, 3
  SnBu3-CH2-NH2: 1
  SnBu3-CH2-OR: 1, 2, 3
  SnBu3-Cl: 1, 2, 3, 4, 5, 6, 7
  SnBu3-Li see: LiSnR3
  SnBu3-OSnBu3: 1
  SnBu3-SiMe3: 1
  SnCl2: 1, 2, 3
  SnCl4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  SnHBu3 - see: HSnBu3
  SnMe3-CH2-NH2: 1
  SnMe3-Cl: 1, 2, 3, 4
  SnMe3-Li - see: LiSnR3
  SnMe3-SnMe3: 1, 2, 3, 4, 5
  SO2: 1, 2, 3
  SO2Cl2: 1, 2, 3
  SO3·Py: 1
  SO3·Py - see: DMSO, Py·SO3
  SOCl2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44
  Sodium - see: Na; Various anions: Azide, Iodide, Carbonate, etc
  Sodium chromate - see: CrO4Na2
  Sparteine: 1
  Sparteine - see: BuLi, Sparteine
  SPh-Cl: 1, 2
  SPh-SiMe3: 1
  Succinate: 1, 2, 3, 4
  Sudan 7B Red: 1
  Sulfate, diethyl: 1
  Sulfate, dimethyl: 1, 2, 3, 4, 5, 6, 7, 8, 9
  Sulfate, magnesium: 1, 2
  Sulfenyl chloride - see: SPh-Cl
  Sulfide, sodium: 1, 2, 3, 4, 5, 6
  Sulfinamide: 1, 2, 3, 4
  Sulfinate, benzene: 1, 2, 3, 4, 5
  Sulfinate, toluene: 1
  Sulfinic acid, benzene: 1
  Sulfonamide, methane: 1
  Sulfonic acid - see: Camphorsulfonic; TsOH; TfOH
  Sulfonic acid, methane: 1, 2, 3, 4
  Sulfonic anhydride, methane: 1, 2, 3
  Sulfonyl chloride - see: TsCl
  Sulfonyl chloride, benzene: 1, 2, 3, 4, 5, 6, 7
  Sulfonyl chloride, methane: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26
  Sulfonyl chloride, methane, NEt3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47
  Sulfonyl chloride, methane, Py: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15
  Sulfuric acid - see: H2SO4
  Sulfuryl chloride - see: SO2Cl2
  Sulphonyl fluoride, perfluorobutyl: 1
  Swern - see: DMSO, (COCl)2
  TASF: 1, 2, 3, 4, 5, 6
  TBAF - see: Fluoride, Bu4N+
  TBAT: 1, 2
  TBDPS-OTf - see: SiPh2tBu-OTf
  TBS-OTf - see: SiMe2tBu-OTf
  Tebbe: 1, 2, 3
  TEMPO: 1, 2, 3, 4, 5
  TePh-TePh - see: Ditelluride, phenyl
  TESO-Tf - see: SiEt3-OTf
  Tetrabutylammonium - see: Azide; Fluoride; Iodide; Periodate
  Tetramethylpiperidide - see: LiTMP
  Tetrapropylammonium - see: RuO4-Pr4N+
  Tf2N-2-Py-5-Cl: 1, 2, 3, 4
  Tf2NH: 1
  Tf2NPh: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
  Tf2O: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
  TFA - see: Acetic acid, trifluoro
  TFAA - see: Acetic anhydride, trifluoro
  TfOH: 1, 2, 3, 4, 5
  Thalium malonate: 1
  ThexylBH2 - see: BH2(Thexyl)
  Thiazolium: 1, 2, 3
  Thiocarbonate - see: S=CX2
  Thiol, (CH2)2-SH: 1, 2, 3, 4, 5, 6, 7
  Thiol, (CH2)3-SH: 1, 2, 3, 4, 5
  Thiol, acetyl: 1
  Thiol, benzothiazole: 1
  Thiol, benzyl: 1
  Thiol, n-butyl: 1
  Thiol, pentafluorophenyl: 1
  Thiol, phenacyl: 1
  Thiol, phenyl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14
  Thiol, propyl: 1, 2, 3
  Thiol, t-butyl: 1, 2
  Thiol, tetrazole: 1, 2, 3
  Thiol, tolyl: 1
  Thiolate - see: CuSR 
  Thiolate, benzyl: 1
  Thiolate, ethyl: 1, 2, 3, 4, 5
  Thiolate, phenyl: 1, 2
  Thiolate, propyl: 1, 2, 3, 4
  Thionyl chloride - see: SOCl2
  Thiourea - see: S=C(NH2)2
  Ti - see: Tebbe
  Ti(OiPr)3Cl: 1
  Ti(OiPr)4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Ti(OiPr)4 - see: Hydroperoxide, Ti(OiPr)4
  Ti(OR)4: 1, 2, 3
  TiBr2(OR)2: 1
  TiCl2(OR)2: 1
  TiCl3: 1, 2, 3, 4, 5, 6
  TiCl3, Zn/Cu: 1, 2
  TiCl4: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21
  TiCl4 - see: CH2Br2, Zn°, TiCl4
  TiCp2Me (Petasis): 1, 2, 3
  TiCp2Me2 (Petatsis): 1
  Tin - see: Sn; Allyl-Sn; etc
  Tin hydride - see: HSnR3c
  TIPSOTf - see: SiiPr3-OTf
  Tl(NO2)3: 1
  Tl2CO3: 1
  TlNO2: 1
  TMEDA: 1, 2, 3, 4, 5, 6, 7, 8, 9
  TMSOTf - see: SiMe3-OTf
  TolSO2Na - see: Sulfinate, toluene
  Toluenesulfonyl - see: Ts; Azide, tosyl
  TOSMIC - see: TsCH2NC
  TPAP - see: RuO4-Pr4N+
  Tri-sec-butylborohydride - see: BHsBu3- Li+; BHsBu3-K+
  Triacetoxyborohydride - see: BH(OAc)3- Me4N+
  Tribromide: 1, 2, 3, 4, 5, 6
  Trichloroacetimidates - see: Acetonitrile, trichloro
  Trichloroacetonitrile - see: Acetonitrile, trichloro
  Trichloroacetyl chloride - see: Acetyl chloride, trichoro
  Triethylamine - see: NEt3
  Triethylborohydride - see: BHEt3-Li+
  Triflic acid - see: TfOH
  Trifluoroacetamide - see: Acetamide, trifluoro
  Trifluoroacetic acid- see: Acetic acid, trifluoro
  Trifluoroacetic anhydride - see: Acetic anhydride, trifluoro
  Trifluoromethanesulfonic acid - see: TfOH
  Trimethylaluminum - see: AlMe3
  Triphosgene: 1
  Triton B: 1, 2, 3, 4
  Trityl - see: Ph3CCl
  Troc-Cl: 1
  Trost bisphosphine: 1, 2
  TsCH2NC: 1, 2
  TsCl: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16
  TsCl, NEt3: 1, 2, 3, 4, 5, 6, 7, 8
  TsCl, Py: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43
  TsN3 - see: Azide, sulfonyl
  TsNClNa: 1, 2, 3
  TsNHNH2 - see: Hydrazine, tosyl
  TsOH: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128
  TsOH·Py: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41
  TunePhos: 1
  Ultrasound: 1
  Vaska's catalyst: 1
  Vilsmeier reagent: 1, 2, 3, 4, 5
  Vinyl-Al: 1, 2, 3, 4
  Vinyl-Br: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  Vinyl-BR2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14
  Vinyl-Cu: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10
  Vinyl-Cu - see: Keywords - Cu-Vinyl
  Vinyl-I: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30
  Vinyl-Li: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35
  Vinyl-Li - see: Propenyl-Li; Keywords - Li-Vinyl
  Vinyl-MgX: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36
  Vinyl-MgX - see: Propenyl-MgX; Keywords - Mg-Vinyl
  Vinyl-NO2 - see: EneNitro
  Vinyl-OAc: 1, 2
  Vinyl-OR: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
  Vinyl-Phosphonate - see: EnePhosphonate
  Vinyl-SiR3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14
  Vinyl-SnR3: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23
  Vinyl-Sulfide/oxide/one - see: EneSulfide/oxide/one
  Vinyl-ZnX: 1, 2, 3, 4, 5
  Vinyl-Zr: 1, 2, 3, 4, 5
  VO(acac)2 - see: Hydroperoxide, tbutyl - VO(acac)2
  VOF3: 1
  W≡CtBu(OtBu)3: 1
  Weinreb acetamide: 1, 2, 3
  Weinreb phosphonate: 1
  Weinreb reagents - see: NMe(OMe)-R; Keyword Index
  Wieland-Miescher: 1, 2, 3, 4, 5, 6, 7, 8
  Wittig reagents - see: PPh3=CR2; Keywords - Wittig
  Y(OTf)3: 1
  Yamaguchi reagent - see: Benzoyl chloride, 2,4,6-trichloro
  Yb(OTf)3: 1, 2, 3
  Yb(thd)3: 1
  Ynamine: 1
  Zn°: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29
  Zn° - see: CH2I2, Zn; CH2Br2, Zn
  Zn(BH4)2: 1, 2
  Zn(CN)2 - see: Cyanide, zinc
  Zn(N3)2 - see: Azide, zinc
  Zn(OTf)2: 1, 2, 3
  Zn/Ag - see: CH2I2, Zn/Ag
  Zn/Cu: 1
  Zn/Cu - see: TiCl3, Zn/Cu
  ZnBr2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11
  ZnCl2: 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20
  ZnCO3: 1
  ZnEt2: 1, 2, 3, 4
  ZnEt2 - see: CH2I2, ZnEt2
  ZnI2: 1, 2, 3
  ZnMe2: 1, 2, 3
  ZrCl4: 1
  ZrCl4 - see: CH2I2, Zn°, ZrCl4
  ZrCp2Cl2: 1
  ZrCp2ClH: 1, 2, 3, 4, 5, 6

Web page created by:
H. J. Reich using WINPLT

Since 06-03-13:

© 2006-2019 Hans J. Reich, All Rights Reserved